A2130112
Beta-Pinene , ≥95% , 127-91-3
Synonym(s):
2(10)-Pinene;Nopinene;Pseudopinene;Terebenthene
CAS NO.：127-91-3
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00063635
EINECS: 204-872-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -61°C |
| Boiling point: | 167°C |
| Density | 0.859 |
| FEMA | 2903 | BETA-PINENE |
| refractive index | 1.4782 |
| Flash point: | 43°C |
| storage temp. | 2-8°C |
| Odor | at 10.00 % in dipropylene glycol. dry woody resinous pine hay green eucalyptus camphoreous |
| Odor Type | herbal |
| Water Solubility | 12mg/L(25 ºC) |
| Merck | 7446 |
| JECFA Number | 1330 |
| Henry's Law Constant | 2.1×10-4 mol/(m3Pa) at 25℃, Plyasunov and Shock (2000) |
| Exposure limits | TLV-TWA: 20 ppm (112 mg/m3) |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | WTARULDDTDQWMU-UHFFFAOYSA-N |
| SMILES | [C@@H]21C(C(C2)C(=C)CC1)(C)C |
| LogP | 4.37 |
| CAS DataBase Reference | 127-91-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Beta-pinene(127-91-3) |
| EPA Substance Registry System | .beta.-Pinene (127-91-3) |
Description and Uses
Beta-pinene is a component of turpentine. Concentrations vary depending on the source and seem to be high er in European (Portuguese) than in Asian (Indonesian) turpentines.
beta-Pinene is an important raw material for the artificial synthesis of various fragrances, camphor, borneol, vitamins A, E, and K, terpene resins, etc. GB 2760-1996 stipulates that it is a permitted fragrance, mainly used to formulate citrus flavorings such as nutmeg and lemon.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304-H315-H317 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P280-P264-P261-P272-P303+P361+P353-P370+P378-P301+P310-P331-P302+P352-P332+P313-P362+P364-P333+P313-P403+P235-P405-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | 2368 |
| WGK Germany | WGK 3 |
| RTECS | DT5077000 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 127-91-3(Hazardous Substances Data) |
