A2179412
17b-hydroxyestr-4-en-3-one 17-(3-phenylpropionate) , 98% , 62-90-8
Synonym(s):
(17β)-17-(1-Oxo-3-phenylpropoxy)estr-4-en-3-one;Nandrolone 3-phenylpropionate;NSC 23162
CAS NO.:62-90-8
Empirical Formula: C27H34O3
Molecular Weight: 406.57
MDL number: MFCD00198407
EINECS: 200-551-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB118.40 | In Stock |
|
| 5G | RMB434.40 | In Stock |
|
| 25g | RMB1452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87°C |
| alpha | D +58° (chloroform) |
| Boiling point: | 487.61°C (rough estimate) |
| Density | 1.0140 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | DMSO : 100 mg/mL (245.97 mM; Need ultrasonic) |
| form | Solid |
| color | White to Off-White |
| InChIKey | UBWXUGDQUBIEIZ-QNTYDACNSA-N |
| SMILES | C[C@]12CC[C@]3([H])[C@@]4([H])CCC(=O)C=C4CC[C@@]3([H])[C@]1([H])CC[C@@H]2OC(=O)CCC1C=CC=CC=1 |&1:1,4,6,16,18,22,r| |
| CAS DataBase Reference | 62-90-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Androstene-17-beta-ol-3-one, 19-nor-delta-, phenylpropionate(62-90-8) |
Description and Uses
Anabolic steroid; androgen.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H360FD |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 23-36 |
| WGK Germany | WGK 3 |
| RTECS | KG7995000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |
| Toxicity | LD50 intraperitoneal in mouse: > 1gm/kg |







