LN6853338
Danazol , 17230-88-5
Synonym(s):
17β-Hydroxy-2,4,17α-pregnadien-20-yno[2,3-d]isoxazole;2,4,17α-Pregnadien-20-yno[2,3-d]-isoxa-zol-17-ol
CAS NO.:17230-88-5
Empirical Formula: C22H27NO2
Molecular Weight: 337.46
MDL number: MFCD00056838
EINECS: 241-270-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224.4-226.80C |
| alpha | D25 +7.5° (ethanol); D25 +21.9° (chloroform) |
| Boiling point: | 473.76°C (rough estimate) |
| Density | 1.0909 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.10±0.60(Predicted) |
| color | White to Pale Yellow |
| Water Solubility | Partly soluble in water. Soluble in chloroform (25 mg/ml), acetone, acetonitrile, and ethanol. 17beta-Hydroxy-2,4,17a-pregnadien-20-yno[2,3-d]isoxazole and 2,4,17a-Pregnadien-20-yno[2,3-d]isoxazol-17-ol are the synonym of this compound. |
| InChI | 1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16,17,18,20,21,22-/m0/s1 |
| InChIKey | POZRVZJJTULAOH-QLPJIZEUNA-N |
| SMILES | [C@]12([H])CC[C@]3(C)[C@](CC[C@@]3([H])[C@]1([H])CCC1=CC3ON=CC=3C[C@]21C)(O)C#C |&1:0,4,6,9,11,23,r| |
| EPA Substance Registry System | Danazol (17230-88-5) |
Description and Uses
anterior pituitary suppressant
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H312+H332-H361 |
| Precautionary statements | P201-P280-P302+P352+P312-P304+P340+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-63-36/37/38 |
| Safety Statements | 22-36-37/39-26 |
| WGK Germany | 3 |
| RTECS | TU4157070 |
| HS Code | 29372900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Repr. 2 |
| Toxicity | dog,LD50,oral,> 5gm/kg (5000mg/kg),Journal of International Medical Research. Vol. 5(Suppl, |







