PRODUCT Properties
| Melting point: | 223-225 °C |
| Boiling point: | 401.12°C (rough estimate) |
| Density | 1.1425 (rough estimate) |
| refractive index | 1.4400 (estimate) |
| storage temp. | room temp |
| solubility | Solubility Slightly soluble in water; soluble in ethanol |
| pka | 9.40(at 25℃) |
| form | powder |
| color | Clear colorless |
| PH | 8.2-9.8, colorless to red |
| PH Range | 8.2 (colorless) - 9.8 (violet/red) |
| Water Solubility | slightly soluble |
| ε(extinction coefficient) | ≥10000 at 294-300nm ≥39000 at 564-570nm ≥5000 at 378-384nm |
| λmax | 566nm, 381nm |
| Merck | 14,2576 |
| BRN | 310554 |
| Major Application | Sensors, display device, photoresists, recording materials, imaging materials, authentication system for secure documents, decoder system, lithium cells, electroplating process, inks, markers, toners, correction fluid, paints, adhesives, floor coatings, gas leaking detector for safety in industries, toys, food storage, diapers, determination of calcium, lotions, urine analysis test strips, drugs, blood analysis |
| InChI | 1S/C22H18O4/c1-13-11-15(7-9-19(13)23)22(16-8-10-20(24)14(2)12-16)18-6-4-3-5-17(18)21(25)26-22/h3-12,23-24H,1-2H3 |
| InChIKey | CPBJMKMKNCRKQB-UHFFFAOYSA-N |
| SMILES | Cc1cc(ccc1O)C2(OC(=O)c3ccccc23)c4ccc(O)c(C)c4 |
| CAS DataBase Reference | 596-27-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxy-3-methylphenyl)- (596-27-0) |
Description and Uses
O-Cresolphthalein has been used as a component in calcifying media for calcification assay. It is also used as an indicator (pH range, 8.2 colorless, 9.8 red) and analytical reagent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H319-H335+H336-H340-H360-H372-H373 |
| Precautionary statements | P201-P202-P210-P233-P240-P241+P242+P243-P260-P264-P270-P271-P280-P303+P361+P353-P304+P340+P312-P305+P351+P338+P337+P313-P308+P313-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 40-36/37/38-20/21/22 |
| Safety Statements | 36/37-36-26 |
| RIDADR | 1170 |
| WGK Germany | 3 |
| RTECS | SM8390000 |
| TSCA | TSCA listed |
| HS Code | 3822.19.0080 |
| Storage Class | 11 - Combustible Solids |





