A2250612
Chromotropic acid disodium salt dihydrate , 98% , 5808-22-0
Synonym(s):
1,8-Dihydroxynaphthalene-3,6-disulfonic acid disodium salt;4,5-Dihydroxy-2,7-naphthalene disulfonic acid sodium salt;4,5-Dihydroxynaphthalene-2,7-disulfonic acid disodium salt;Chromotropic acid disodium salt dihydrate
CAS NO.:5808-22-0
Empirical Formula: C10H10Na2O10S2
Molecular Weight: 400.29
MDL number: MFCD00150612
EINECS: 611-619-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 10G | RMB61.60 | In Stock |
|
| 25G | RMB156.00 | In Stock |
|
| 50G | RMB232.80 | In Stock |
|
| 100G | RMB430.40 | In Stock |
|
| 250G | RMB1033.60 | In Stock |
|
| 500g | RMB2631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| bulk density | 780kg/m3 |
| storage temp. | Store below +30°C. |
| solubility | 170g/l |
| form | Powder |
| Colour Index | 57030 |
| color | off-white |
| PH | 3.6 (10g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. |
| Merck | 14,2241 |
| BRN | 3647189 |
| Stability: | Stable. Incompatible with strong oxidizers, strong acids, acid chlorides, acid anhydrides. Light sensitive. |
| InChI | InChI=1S/C10H8O8S2.Na.H2O.H/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8;;;/h1-4,11-12H,(H,13,14,15)(H,16,17,18);;1H2; |
| InChIKey | VMMMUWCNLBLZFD-UHFFFAOYSA-N |
| SMILES | OC1C=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C=C(O)C=12.[NaH].O |
| CAS DataBase Reference | 5808-22-0(CAS DataBase Reference) |
Description and Uses
Chromotropic acid disodium salt dihydrate may be employed as a chromogenic reagent for the quantification of dipyrone in various pharmaceutical preparations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29089990 |






