PRODUCT Properties
| Melting point: | >300°C |
| bulk density | 500kg/m3 |
| storage temp. | Store at +15°C to +25°C. |
| Water Solubility | Soluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| color | Bright orange |
| InChI | InChI=1S/C17H13NO8S2.Na.H/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);;/b18-9+;; |
| InChIKey | MLMFPVVHWYCLSL-IFJQNBRBSA-N |
| SMILES | N(/C1=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC(O)=C12)=C\C1C=CC=CC=1O.[NaH] |
| CAS DataBase Reference | 5941-07-1(CAS DataBase Reference) |
Description and Uses
Azomethine-H Monosodium is used to make optically transparent thin films with photochromic properties.






