PRODUCT Properties
| Melting point: | >300°C |
| bulk density | 500kg/m3 |
| storage temp. | Store at +15°C to +25°C. |
| Water Solubility | Soluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| color | Bright orange |
| InChI | InChI=1S/C17H13NO8S2.Na.H/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);;/b18-9+;; |
| InChIKey | MLMFPVVHWYCLSL-IFJQNBRBSA-N |
| SMILES | N(/C1=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC(O)=C12)=C\C1C=CC=CC=1O.[NaH] |
| CAS DataBase Reference | 5941-07-1(CAS DataBase Reference) |
Description and Uses
Azomethine-H Monosodium is used to make optically transparent thin films with photochromic properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 32041400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
