A2251212
4-Chloro-L-phenylalanine , 98% , 14173-39-8
Synonym(s):
L -PCPA
CAS NO.：14173-39-8
Empirical Formula: C9H10ClNO2
Molecular Weight: 199.63
MDL number: MFCD00063065
EINECS: 238-023-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB114.40 | In Stock |
|
| 25G | RMB492.80 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263 °C (dec.)(lit.) |
| Boiling point: | 339.5±32.0 °C(Predicted) |
| alpha | -27 º (c=0.5, H2O 34 ºC) |
| Density | 1.2409 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| storage temp. | -20°C |
| solubility | Aqueous Base (Slightly), Water (Slightly) |
| form | Powder |
| pka | 2.18±0.10(Predicted) |
| color | White |
| optical activity | Consistent with structure |
| Water Solubility | Soluble in acetic acid. Slightly soluble in water. |
| BRN | 2416150 |
| InChI | InChI=1S/C9H10ClNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | NIGWMJHCCYYCSF-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(Cl)C=C1)N |
| CAS DataBase Reference | 14173-39-8(CAS DataBase Reference) |
Description and Uses
4-Chloro-L-phenylalanine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317 |
| Precautionary statements | P280-P301+P310-P261-P280g-P301+P310a-P321-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-43 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
