A2253012
4-Chlorocinnamic acid , 99% , 1615-02-7
Synonym(s):
trans-3-(4-Chlorophenyl)propenoic acid
CAS NO.：1615-02-7
Empirical Formula: C9H7ClO2
Molecular Weight: 182.6
MDL number: MFCD00004396
EINECS: 216-564-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB171.20 | In Stock |
|
| 500G | RMB573.60 | In Stock |
|
| 2.5kg | RMB2100.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-250 °C(lit.) |
| Boiling point: | 260.71°C (rough estimate) |
| Density | 1.2377 (rough estimate) |
| refractive index | 1.5426 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| pka | 4.41(at 25℃) |
| color | White |
| BRN | 1365308 |
| InChI | InChI=1S/C9H7ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12) |
| InChIKey | GXLIFJYFGMHYDY-ZZXKWVIFSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1615-02-7(CAS DataBase Reference) |
| NIST Chemistry Reference | p-Chlorocinnamic acid(1615-02-7) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(4-chlorophenyl)- (1615-02-7) |
Description and Uses
4-Chlorocinnamic Acid is a derivative of Cinnamic Acid (C442030) and plays an important role in the development of plants. 4-Chlorocinnamic Acid may also show potential antimicrobial, antioxidant, anti-inflammatory, and antitumoral activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 36-28A-26-24/25 |
| WGK Germany | 3 |
| RTECS | GD8490000 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
