A2255212
Cytidine 5'-monophosphate , 99% , 63-37-6
Synonym(s):
5′-CMP;5′-Cytidylic acid;C-5′-P;Cytidine 5′-monophosphate
CAS NO.:63-37-6
Empirical Formula: C9H14N3O8P
Molecular Weight: 323.2
MDL number: MFCD00006544
EINECS: 200-556-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~222 °C (dec.) |
| Boiling point: | 678.1±65.0 °C(Predicted) |
| Density | 2.15±0.1 g/cm3(Predicted) |
| refractive index | 9.8 ° (C=1, 0.5mol/L Na2HPO4) |
| storage temp. | 2-8°C |
| solubility | Water (Slightly, Heated) |
| pka | pK2:4.39(0);pK3:6.62(+1) (25°C) |
| form | crystalline |
| color | White |
| biological source | synthetic |
| Water Solubility | soluble |
| BRN | 46982 |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | IERHLVCPSMICTF-JDNPWWSISA-N |
| SMILES | P(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](O)[C@@H]1O)(O)(O)=O |
| CAS DataBase Reference | 63-37-6(CAS DataBase Reference) |
| EPA Substance Registry System | 5'-Cytidylic acid (63-37-6) |
Description and Uses
Cytidine 5'-monophosphate, also known as 5'-CMP, is a nucleotide that is used as a monomer in RNA. 5'-CMP is a key intermediate in the preparation of several nucleotide derivatives and is widely used in food and pharmaceutical industries.
Cytidine 5′-monophosphate has been used in Raman spectroscopy studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-36-26 |
| WGK Germany | 3 |
| RTECS | HA3980000 |
| F | 10-21 |
| HS Code | 29349990 |
| Toxicity | LD50 intraperitoneal in mouse: > 1gm/kg |



