A2255312
Calcium trifluoromethanesulfonate , 98% , 55120-75-7
Synonym(s):
Calcium triflate
CAS NO.：55120-75-7
Empirical Formula: C2CaF6O6S2
Molecular Weight: 338.22
MDL number: MFCD00143911
EINECS: 628-642-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB100.00 | In Stock |
|
| 10G | RMB143.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 50G | RMB545.60 | In Stock |
|
| 100G | RMB910.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 350 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White |
| Water Solubility | Soluble in water. |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| Stability: | hygroscopic |
| InChI | InChI=1S/2CHF3O3S.Ca/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChIKey | PUQLFUHLKNBKQQ-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Ca+2] |
| CAS DataBase Reference | 55120-75-7(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, calcium salt (55120-75-7) |
Description and Uses
Calcium trifluoromethanesulfonate is used for aminolysis of epoxides.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H314 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 26-27-36/37/39-45-36 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| HS Code | 29319090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
