A5070112
Iron trifluoromethanesulfonate , 90% , 63295-48-7
Synonym(s):
Fe(OTf)3;Ferric triflate;Iron(III) triflate;Ferric trifluoromethanesulfonate;Iron 1,1,1-trifluoromethanesulfonic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB187.20 | In Stock |
|
| 25G | RMB669.60 | In Stock |
|
| 100G | RMB2340.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183 °C |
| Flash point: | 110°(230°F) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Water Solubility | Soluble in water, methanol and acetonitrile. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/CHF3O3S.Fe/c2-1(3,4)8(5,6)7;/h(H,5,6,7); |
| InChIKey | QZLVALRWETVYSE-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(O)(=O)=O.[Fe] |
| CAS DataBase Reference | 63295-48-7 |
Description and Uses
Iron(III) triflate is used as an efficient catalyst in the synthesis of 2,3-unsaturated-O-glycosides from 2,4,6-tri-O-acetyl-D-glucal. It is also involved in the synthesis of a variety of beta-enamino ketones and esters.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






