A4972412
Iron trifluoromethanesulfonate , 95% , 59163-91-6
Synonym(s):
Iron(II) triflate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB553.60 | In Stock |
|
| 100G | RMB1739.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated, Sonicated) |
| form | Powder |
| color | off-white to brown |
| Stability: | hygroscopic |
| InChI | InChI=1S/2CHF3O3S.Fe/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChIKey | PGJLOGNVZGRMGX-UHFFFAOYSA-L |
| SMILES | S(=O)(=O)(O[Fe]OS(=O)(=O)C(F)(F)F)C(F)(F)F |
Description and Uses
Iron(II) Trifluoromethanesulfonate acts as a catalyst for hydrosilylation and hydroboration of alkenes and alkynes to give silane and borane adducts. Reagent in the preparation of organometallic inhibitors of UFM1-activating enzymes UBAS.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3260 8 / PGII |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 2904990090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
