A2255912
4-Carboxyphenylboronic acid (contains varying amounts of Anhydride) , 97% , 14047-29-1
Synonym(s):
4-Boronobenzoic acid;4-Carboxybenzeneboronic acid;4-Carboxylphenylboronic acid;4-Hydroxycarbonylphenyl boronic acid;p-Boronobenzoic acid
CAS NO.：14047-29-1
Empirical Formula: C7H7BO4
Molecular Weight: 165.94
MDL number: MFCD00151801
EINECS: 604-189-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB368.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220 °C (dec.) (lit.) |
| Boiling point: | 406.4±47.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Powder |
| pka | 4.08±0.10(Predicted) |
| color | Off-white to light beige |
| BRN | 3031088 |
| InChI | InChI=1S/C7H7BO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,11-12H,(H,9,10) |
| InChIKey | SIAVMDKGVRXFAX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(B(O)O)C=C1 |
| CAS DataBase Reference | 14047-29-1(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H303-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 2 |
| RTECS | CY8925000 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
