A4705912
Homophthalic acid , 98% , 89-51-0
Synonym(s):
α-Carboxy-o-toluic acid;2-Carboxyphenylacetic acid
CAS NO.:89-51-0
Empirical Formula: C9H8O4
Molecular Weight: 180.16
MDL number: MFCD00004326
EINECS: 201-913-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB279.20 | In Stock |
|
| 50g | RMB503.20 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-182 °C (lit.) |
| Boiling point: | 389.5±17.0 °C(Predicted) |
| Density | 1.392±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | Powder |
| pka | 3.72±0.36(Predicted) |
| color | Off-white to light yellow or pale green |
| Water Solubility | 12 g/L (20 ºC) |
| BRN | 1872069 |
| InChI | InChI=1S/C9H8O4/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13) |
| InChIKey | ZHQLTKAVLJKSKR-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1C(O)=O |
| CAS DataBase Reference | 89-51-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetic acid, 2-carboxy- (89-51-0) |
Description and Uses
antidepressant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36/37/39-27 |
| WGK Germany | 3 |
| RTECS | CY1575590 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |





