A2257012
2-Chloro-3-methylthiophene , 97% , 14345-97-2
CAS NO.:14345-97-2
Empirical Formula: C5H5ClS
Molecular Weight: 132.61
MDL number: MFCD00130083
EINECS: 238-296-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB376.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-157 °C |
| Boiling point: | 147-149 °C (lit.) |
| Density | 1.211 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 115 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H5ClS/c1-4-2-3-7-5(4)6/h2-3H,1H3 |
| InChIKey | KQFADYXPELMVHE-UHFFFAOYSA-N |
| SMILES | C1(Cl)SC=CC=1C |
| CAS DataBase Reference | 14345-97-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H318 |
| Precautionary statements | P210-P233-P240-P280-P301+P312-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-22-41-36/37/38 |
| Safety Statements | 16-26-39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









