A2517012
4-(Chloromethyl)benzoic acid , ≥98.0%(HPLC) , 1642-81-5
Synonym(s):
α-Chloro-p-toluic acid;α-Chloro-p-toluylic acid
CAS NO.：1642-81-5
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00002568
EINECS: 216-697-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB108.00 | In Stock |
|
| 250G | RMB243.20 | In Stock |
|
| 500G | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-202 °C(lit.) |
| Boiling point: | 201-203 °C |
| Density | 1.315±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.11±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1907970 |
| InChI | InChI=1S/C8H7ClO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | OITNBJHJJGMFBN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 1642-81-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Chloromethyl)benzoic acid(1642-81-5) |
Description and Uses
4-(Chloromethyl)benzoic acid was used in the synthesis of dihydroxy stilbene derivatives.
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H334 |
| Precautionary statements | P260-P280-P284-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-42/43-36 |
| Safety Statements | 26-36/37/39-45-22-27-37/37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
