A2273912
4-(Chloromethyl)benzoyl chloride , 98% , 876-08-4
CAS NO.:876-08-4
Empirical Formula: C8H6Cl2O
Molecular Weight: 189.04
MDL number: MFCD00053224
EINECS: 212-881-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB173.60 | In Stock |
|
| 500G | RMB592.00 | In Stock |
|
| 2.5kg | RMB2316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-32 °C(lit.) |
| Boiling point: | 126-128 °C6 mm Hg(lit.) |
| Density | 1.2979 (rough estimate) |
| refractive index | 1.5605 (estimate) |
| Flash point: | 199 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | Low Melting Crystalline Mass |
| color | White to light beige |
| InChI | InChI=1S/C8H6Cl2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2 |
| InChIKey | RCOVTJVRTZGSBP-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 876-08-4(CAS DataBase Reference) |
Description and Uses
4-(Chloromethyl)benzoyl chloride was used as an atom transfer radical polymerization (ATRP) initiator in the growth of polyacrylamide (PAAm) brushes from silicon wafers. It was also used as a building block in a microwave-assisted, solid-phase synthesis of imatinib, an anticancer agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 23-26-27-36/37/39-45-25 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |








