A6163312
2-Nitrobenzoyl chloride , 96% , 610-14-0
CAS NO.：610-14-0
Empirical Formula: C7H4ClNO3
Molecular Weight: 185.56
MDL number: MFCD00007131
EINECS: 210-206-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17-20 °C (lit.) |
| Boiling point: | 148-149 °C/9 mmHg (lit.) |
| Density | 1.404 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 0-6°C |
| form | Liquid After Melting |
| color | Clear yellow to orange to dark brown |
| BRN | 777991 |
| InChI | 1S/C7H4ClNO3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H |
| InChIKey | BWWHTIHDQBHTHP-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccccc1C(Cl)=O |
| CAS DataBase Reference | 610-14-0(CAS DataBase Reference) |
| NIST Chemistry Reference | o-Nitrobenzoyl chloride(610-14-0) |
| EPA Substance Registry System | o-Nitrobenzoyl chloride (610-14-0) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 5-34 |
| Safety Statements | 26-36/37/39-45-7/9-38 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6650000 |
| F | 4.4-9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
