A2257912
2-Chloro-5-nitrobenzophenone , 98% , 34052-37-4
CAS NO.：34052-37-4
Empirical Formula: C13H8ClNO3
Molecular Weight: 261.66
MDL number: MFCD00007295
EINECS: 251-811-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB116.00 | In Stock |
|
| 25G | RMB360.00 | In Stock |
|
| 100G | RMB1117.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85 °C(lit.) |
| Boiling point: | 235°C (rough estimate) |
| Density | 1.3227 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C13H8ClNO3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H |
| InChIKey | HRPHZUAPQWJPCZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(c1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 34052-37-4(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-nitrobenzophenone is used as a reagent in the synthesis of bile acid transporter inhibitors in the treatment of atherosclerosis. Also used in the synthesis of antiinflammatory agents.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
