A2258512
2-Chloro-3-bromo thiophene , 97% , 40032-73-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70 °C9 mm Hg(lit.) |
| Density | 1.808 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Specific Gravity | 1.827 |
| Water Solubility | < 0.2 g/l (20 ºC) |
| BRN | 1205539 |
| InChI | InChI=1S/C4H2BrClS/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | KSHOQKKCPJELBV-UHFFFAOYSA-N |
| SMILES | C1(Cl)SC=CC=1Br |
| CAS DataBase Reference | 40032-73-3(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-chlorothiophene is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H227-H302-H312-H331 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P210e-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29349990 |
