A2262112
cis-1,2,3,6-Tetrahydrophthalimide , 96% , 1469-48-3
CAS NO.：1469-48-3
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00005880
EINECS: 215-999-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB78.40 | In Stock |
|
| 500G | RMB360.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-133 °C(lit.) |
| Boiling point: | 142-146 °C(Press: 2 Torr) |
| Density | 1.228±0.06 g/cm3(Predicted) |
| Flash point: | 178 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 11.69±0.20(Predicted) |
| form | Powder or Flakes |
| color | Pale yellow or light beige to yellow-brownish or flakes |
| BRN | 82338 |
| InChI | InChI=1/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-2,5-6H,3-4H2,(H,9,10,11)/t5-,6+ |
| InChIKey | CIFFBTOJCKSRJY-OLQVQODUNA-N |
| SMILES | C1(=O)[C@]2([H])[C@@]([H])(CC=CC2)C(=O)N1 |&1:2,4,r| |
| CAS DataBase Reference | 1469-48-3(CAS DataBase Reference) |
Description and Uses
cis-Tetrahydrophthalimide is an intermediate to synthesize cis-Captafol (C175740), which was used as a fungicide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H303-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P312-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xn |
| Risk Statements | 20/21 |
| Safety Statements | 7-36/37/39-24/25 |
| WGK Germany | 3 |
| RTECS | GW4635000 |
| HS Code | 29251900 |
