A2568712
<i>cis</i>-1,2-Cyclohexanediamine , 97% , 1436-59-5
Synonym(s):
cis-1,2-Cyclohexanediamine
CAS NO.:1436-59-5
Empirical Formula: C6H14N2
Molecular Weight: 114.19
MDL number: MFCD00063746
EINECS: 205-754-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 10g | RMB127.20 | In Stock |
|
| 25G | RMB333.60 | In Stock |
|
| 100g | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8°C |
| Boiling point: | 92-93 °C/18 mmHg (lit.) |
| Density | 0.952 g/mL at 25 °C (lit.) |
| vapor pressure | 0.4 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 161 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Completely miscible in water |
| pka | 9.93(at 20℃) |
| form | Low Melting Solid |
| color | Brown |
| InChI | InChI=1/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6+ |
| InChIKey | SSJXIUAHEKJCMH-OLQVQODUSA-N |
| SMILES | [C@@H]1(N)CCCC[C@@H]1N |&1:0,6,r| |
| CAS DataBase Reference | 1436-59-5(CAS DataBase Reference) |
| NIST Chemistry Reference | cis-1,2-Cyclohexanediamine(1436-59-5) |
Description and Uses
cis-1,2-Diaminocyclohexane was used in the synthesis of platinum complexes that have high antitumor activity.It was also used in the synthesis of multidentate ligands for uranyl and transition metal complexation.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







