A2265212
Clonidine hydrochloride , 98% , 4205-91-8
Synonym(s):
2-(2,6-Dichloroanilino)-2-imidazoline hydrochloride;2-(4,6-Dichloro-2-methyl-1h-indol-3-yl)ethanamine;4,6-Dichloro-2-methyl-3-aminoethylindole
CAS NO.:4205-91-8
Empirical Formula: C9H10Cl3N3
Molecular Weight: 266.55
MDL number: MFCD00036705
EINECS: 224-121-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB40.00 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB148.00 | In Stock |
|
| 25g | RMB480.80 | In Stock |
|
| 100G | RMB1656.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 312 °C |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | solid |
| color | white |
| PH | pH(50g/l, 25℃) : 3.5~6.0 |
| Water Solubility | Soluble in water (50 mg/ml), DMSO (75 mM), methanol, chloroform (slightly), and dehydrated alcohol. |
| Merck | 14,2390 |
| BRN | 4163525 |
| BCS Class | 1 (LogP),
3 (CLogP) |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H9Cl2N3.ClH/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;/h1-3H,4-5H2,(H2,12,13,14);1H |
| InChIKey | GLEWMLFXCSBZLK-UHFFFAOYSA-N |
| SMILES | C1(=C(Cl)C=CC=C1Cl)NC1=NCCN1.Cl |
| CAS DataBase Reference | 4205-91-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazol-2-amine, N-(2,6-dichlorophenyl)-4,5-dihydro-, hydrochloride (1:1) (4205-91-8) |
Description and Uses
In shaving soaps.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H330 |
| Precautionary statements | P260-P301+P330+P331+P310-P304+P340+P310-P403+P233 |
| Hazard Codes | T+ |
| Risk Statements | 25-26 |
| Safety Statements | 22-26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | NJ2490000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933290000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Oral |
| Toxicity | LD50 in mice, rats (mg/kg): 328, 270 orally; 18, 29 i.v. (Walland) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (300g or 300ml) |






