A2266312
2-Chloro-6-fluorobenzaldehyde , 95% , 387-45-1
CAS NO.：387-45-1
Empirical Formula: C7H4ClFO
Molecular Weight: 158.56
MDL number: MFCD00003306
EINECS: 206-860-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB30.40 | In Stock |
|
| 100G | RMB88.80 | In Stock |
|
| 500G | RMB300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-35 °C(lit.) |
| Boiling point: | 92 °C (10 mmHg) |
| Density | 1.3310 (estimate) |
| Flash point: | 215 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Solid |
| color | White to yellow |
| Water Solubility | Insoluble |
| Sensitive | Air Sensitive |
| BRN | 2245530 |
| InChI | InChI=1S/C7H4ClFO/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| InChIKey | OACPOWYLLGHGCR-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 387-45-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 2-chloro-6-fluoro- (387-45-1) |
Description and Uses
2-Chloro-6-fluorobenzaldehyde was used in the synthesis of novel copolymers of methyl 2-cyano-3-dihalophenyl-2-propenoates and styrene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 1 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
