A2266412
4-Chloro-2-nitrobenzoic acid , 98% , 6280-88-2
CAS NO.:6280-88-2
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00007214
EINECS: 228-483-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB117.60 | In Stock |
|
| 500G | RMB383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143 °C (lit.) |
| Boiling point: | 160.5°C (rough estimate) |
| Density | 1.5 |
| refractive index | 1.6000 (estimate) |
| Flash point: | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 5.3g/l |
| pka | 1.97±0.25(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 0.53 g/100 mL (15 ºC) |
| BRN | 2051370 |
| InChI | 1S/C7H4ClNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JAHIPDTWWVYVRV-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 6280-88-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-2-nitrobenzoic acid(6280-88-2) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






