A2268812
1-Cyclohexyl-2-pyrrolidone , 99% , 6837-24-7
CAS NO.:6837-24-7
Empirical Formula: C10H17NO
Molecular Weight: 167.25
MDL number: MFCD00003191
EINECS: 229-919-7
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB29.60 | In Stock |
|
| 50ML | RMB39.20 | In Stock |
|
| 100ML | RMB92.80 | In Stock |
|
| 250ML | RMB175.20 | In Stock |
|
| 500ML | RMB401.60 | In Stock |
|
| 2.5L | RMB1213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12 °C |
| Boiling point: | 154 °C7 mm Hg(lit.) |
| Density | 1.007 g/mL at 25 °C(lit.) |
| vapor pressure | 0.05 mm Hg ( 25 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | -0.49±0.20(Predicted) |
| color | Colorless to Orange to Green |
| Water Solubility | Soluble |
| BRN | 121832 |
| InChI | InChI=1S/C10H17NO/c12-10-7-4-8-11(10)9-5-2-1-3-6-9/h9H,1-8H2 |
| InChIKey | PZYDAVFRVJXFHS-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC2)CCCC1=O |
| CAS DataBase Reference | 6837-24-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Pyrrolidinone, 1-cyclohexyl- (6837-24-7) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312-H314 |
| Precautionary statements | P260-P280-P301+P312+P330-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T+,C |
| Risk Statements | 22-36/37/38-26-21/22-34 |
| Safety Statements | 23-24/25-45-38-36/37/39-28A-26 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 1 |
| RTECS | UY5748450 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






