A2269612
2-Chloro-3-fluoropyridine , 98% , 17282-04-1
CAS NO.：17282-04-1
Empirical Formula: C5H3ClFN
Molecular Weight: 131.54
MDL number: MFCD03095302
EINECS: 629-118-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C/80 mmHg (lit.) |
| Density | 1.323 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 147 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | -0.05±0.10(Predicted) |
| color | Colorless to Almost colorless |
| BRN | 1363435 |
| InChI | InChI=1S/C5H3ClFN/c6-5-4(7)2-1-3-8-5/h1-3H |
| InChIKey | SVAZIMBLBHOVIR-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1F |
| CAS DataBase Reference | 17282-04-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41-36/37/38-37/38-23/24/25 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
