A2269812
2-Chloro-5-hydroxypyridine , 97% , 41288-96-4
CAS NO.：41288-96-4
Empirical Formula: C5H4ClNO
Molecular Weight: 129.54
MDL number: MFCD00234050
EINECS: 670-289-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB272.80 | In Stock |
|
| 100G | RMB945.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-158°C |
| Boiling point: | 351.9±22.0 °C(Predicted) |
| Density | 1.392±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.69±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H |
| InChIKey | KVCOOWROABTXDJ-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1O |
| CAS DataBase Reference | 41288-96-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36-37 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
