A2269712
2-Chloro-5-fluoropyridine , 98% , 31301-51-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB207.20 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 19℃ |
| Boiling point: | 74 °C / 38mmHg |
| Density | 1.297 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 108 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.20±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| InChI | InChI=1S/C5H3ClFN/c6-5-2-1-4(7)3-8-5/h1-3H |
| InChIKey | QOGXQLSFJCIDNY-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C=C1 |
| CAS DataBase Reference | 31301-51-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-fluoropyridine, is the intermediate used for the synthesis of pharmaceuticals agents and biologically active compounds, such as pyrazol-3-ylamino pyrazines as novel JAK2 inhibitors.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H315-H318-H335 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-22-37/38-41-36/37/38 |
| Safety Statements | 26-36/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
