A2273312
Cyclopentene oxide , 97% , 285-67-6
Synonym(s):
1,2-Epoxycyclopentane;6-Oxabicyclo[3.1.0]hexane
CAS NO.:285-67-6
Empirical Formula: C5H8O
Molecular Weight: 84.12
MDL number: MFCD00005161
EINECS: 206-005-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB153.60 | In Stock |
|
| 100G | RMB456.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-137 °C |
| Boiling point: | 102 °C(lit.) |
| Density | 0.964 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to very faintly yellow |
| Water Solubility | Immiscible with water. |
| BRN | 102495 |
| InChI | InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 |
| InChIKey | GJEZBVHHZQAEDB-UHFFFAOYSA-N |
| SMILES | C12C(O1)CCC2 |
| LogP | 0.908 (est) |
| CAS DataBase Reference | 285-67-6(CAS DataBase Reference) |
| NIST Chemistry Reference | cis-1,2-Epoxycyclopentane(285-67-6) |
| EPA Substance Registry System | 6-Oxabicyclo[3.1.0]hexane (285-67-6) |
Description and Uses
Cyclopentene oxide is used to prepare beta-amino alcohols by reacting with aromatic amines using bismuth trichloride as a catalyst.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36-36/37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| RTECS | RN8935000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29109000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 285-67-6(Hazardous Substances Data) |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







