A2273612
D-Cystine , 98% , 349-46-2
Synonym(s):
(S,S)-3,3′-Dithiobis(2-aminopropionic acid)
CAS NO.:349-46-2
Empirical Formula: C6H12N2O4S2
Molecular Weight: 240.3
MDL number: MFCD00002610
EINECS: 206-486-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB721.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265 °C (dec.) (lit.) |
| alpha | 214 º (c=1, 1 N HCl) |
| Boiling point: | 468.2±45.0 °C(Predicted) |
| Density | 1.358 (estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly) |
| pka | 1.70±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| optical activity | [α]20/D +212°, c = 1 in 1 M HCl |
| Water Solubility | 0.057 g/L (25 ºC) |
| Merck | 14,2782 |
| BRN | 1728093 |
| Major Application | peptide synthesis |
| InChI | 1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| InChIKey | LEVWYRKDKASIDU-QWWZWVQMSA-N |
| SMILES | N[C@H](CSSC[C@@H](N)C(O)=O)C(O)=O |
| LogP | 1.230 (est) |
| CAS DataBase Reference | 349-46-2(CAS DataBase Reference) |
Description and Uses
D-cystine is a thiol-containing non-essential amino acid that is oxidized to form CYSTINE.
D-Cystine increases the rate of fertilization of mouse oocytes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29309013 |
| Storage Class | 11 - Combustible Solids |






