A2274112
2-Chloroadenosine , 99% , 146-77-0
Synonym(s):
2-CADO;6-Amino-2-chloropurine riboside
CAS NO.:146-77-0
Empirical Formula: C10H12ClN5O4
Molecular Weight: 301.69
MDL number: MFCD00005734
EINECS: 205-678-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB32.00 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB181.60 | In Stock |
|
| 25G | RMB668.00 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162 °C |
| Boiling point: | 591.8±60.0 °C(Predicted) |
| Density | 1.8359 (rough estimate) |
| refractive index | -50 ° (C=0.1, H2O) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: 10 mg/mL, clear, colorless |
| form | Solid |
| pka | 13.05±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | Soluble in water. |
| BRN | 43957 |
| InChI | InChI=1S/C10H12ClN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | BIXYYZIIJIXVFW-UUOKFMHZSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=C(Cl)N=3)N)N=C2)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 146-77-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Adenosine, 2-chloro-(146-77-0) |
Description and Uses
A selective A1-adenosine receptor agonist. Induces apoptosis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AU7357550 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in mouse: > 100mg/kg |





![(3aS,4S,6R,6aR)-6-(6-Amino-2-chloro-9H-purin-9-yl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/72209-19-9.gif)
