A2277912
4-Chlorophenylacetic acid , 99% , 1878-66-6
CAS NO.:1878-66-6
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00004344
EINECS: 217-521-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB74.40 | In Stock |
|
| 500G | RMB226.40 | In Stock |
|
| 2.5KG | RMB912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C(lit.) |
| Boiling point: | 241.44°C (rough estimate) |
| Density | 1.2315 (rough estimate) |
| refractive index | 1.5660 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble100mg/mL, clear, faintly yellow |
| pka | 4.19(at 25℃) |
| form | Powder |
| color | White to cream |
| PH | 2.5-3 (100g/l, H2O, 20℃)suspension |
| BRN | 1072816 |
| InChI | InChI=1S/C8H7ClO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | CDPKJZJVTHSESZ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1878-66-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, p-chlorophenyl-(1878-66-6) |
| EPA Substance Registry System | p-Chlorophenylacetic acid (1878-66-6) |
Description and Uses
4-Chlorophenylacetic acid was used to study the mechanism of aerobic degradation of 1,1-dichloro-2,2-bis(4-chlorophenyl)ethane by Ralstonia eutropha A5.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21-36/37/38 |
| Safety Statements | 36/37-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | AG0590000 |
| F | 13 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | mouse,LD50,intraperitoneal,1350mg/kg (1350mg/kg),Farmaco, Edizione Scientifica. Vol. 13, Pg. 286, 1958. |






