A2278612
Cholic acid , 98% , 81-25-4
Synonym(s):
3α,7α,12α-Trihydroxy-5β-cholanic acid;Cholanic acid
CAS NO.:81-25-4
Empirical Formula: C24H40O5
Molecular Weight: 408.58
MDL number: MFCD00003672
EINECS: 201-337-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.00 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB358.40 | In Stock |
|
| 250g | RMB799.20 | In Stock |
|
| 500G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-201 °C (lit.) |
| alpha | 36 º (c=0.6, 95% EtOH) |
| Boiling point: | 449.08°C (rough estimate) |
| Density | 1.0310 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| form | Solid |
| pka | 4.98(at 20℃) |
| color | White to Brown |
| biological source | bovine bile |
| optical activity | Consistent with structure |
| Water Solubility | 0.28 g/L (15 ºC) |
| Merck | 14,2203 |
| BRN | 2822009 |
| InChIKey | BHQCQFFYRZLCQQ-OELDTZBJSA-N |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]3([H])C[C@H](O)[C@]4(C)[C@]([H])(CC[C@@]4([H])[C@]3([H])[C@H](O)C2)[C@H](C)CCC(O)=O |
| LogP | 2.03-2.615 at 20℃ |
| CAS DataBase Reference | 81-25-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Cholic acid(81-25-4) |
| EPA Substance Registry System | Cholan-24-oic acid, 3,7,12-trihydroxy-, (3.alpha.,5.beta.,7.alpha.,12.alpha.)- (81-25-4) |
Description and Uses
asthma therapeutic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | FZ9350000 |
| TSCA | TSCA listed |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 81-25-4(Hazardous Substances Data) |





