A8325912
Ursodeoxycholic acid , 99% , 128-13-2
Synonym(s):
3α,7β-Dihydroxy-5β-cholan-24-oic acid;5β-Cholan-24-oic acid-3α,7β-diol;7β-Hydroxylithocholic acid;UDCS;Ursodeoxycholic acid
CAS NO.:128-13-2
Empirical Formula: C24H40O4
Molecular Weight: 392.57
MDL number: MFCD00003680
EINECS: 204-879-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB194.40 | In Stock |
|
| 100G | RMB696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-204 °C (lit.) |
| Boiling point: | 437.26°C (rough estimate) |
| alpha | 60 º (c=2, EtOH) |
| Density | 0.9985 (rough estimate) |
| refractive index | 60.5 ° (C=2, EtOH) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | ethanol: 50 mg/mL, clear |
| pka | pKa 5.04±0.04(H2O
t = 25.0±0.1
I = 0.00)(Approximate) |
| form | Solid. Powder. |
| color | White - almost white. |
| Water Solubility | practically insoluble |
| Merck | 14,9889 |
| BRN | 3219888 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS SKIN PROTECTING |
| InChIKey | RUDATBOHQWOJDD-UZVSRGJWSA-N |
| SMILES | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| LogP | 3-3.38 at 20℃ |
| CAS DataBase Reference | 128-13-2(CAS DataBase Reference) |
Description and Uses
Ursodeoxycholic acid (UDCS) is a cell protectant used extensively to mitigate hepatic and biliary diseases. Ursodeoxycholic acid may be used to study its specific activities that range from reduction of cholesterol absorpition, cholesterol gallstone dissolution to suppression of immune response. It is also used as an anticholelithogenic. Epimer with Chenodiol with respect to the hydroxyl group at C7.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | FZ2000000 |
| F | 10 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | LD50 in mice (g/kg): 0.1 i.v. (Ardenne, Reitnauer); in rats, mice (mg/kg): 2000, 6000 s.c.; 1000, 1200 i.p., 310, 260 i.v. (Ward) |




