A2281012
γ-Cyclodextrin , 98%, for cell culture , 17465-86-0
Synonym(s):
γ-Cyclodextrin;Cyclomaltooctaose;Cyclooctaamylose;Schardinger γ-Dextrin
CAS NO.:17465-86-0
Empirical Formula: C48H80O40
Molecular Weight: 1297.12
MDL number: MFCD00009595
EINECS: 241-482-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5g | RMB47.20 | In Stock |
|
| 25g | RMB116.80 | In Stock |
|
| 100g | RMB327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| Boiling point: | 845.2°C (rough estimate) |
| alpha | [α]D25 +174~+179° (c=1, H2O) (After Drying) |
| Density | 1.2064 (rough estimate) |
| refractive index | 1.7500 (estimate) |
| Flash point: | 450℃ |
| storage temp. | room temp |
| solubility | 1 M NaOH: 25 mg/mL, may be clear to slightly hazy |
| form | powder |
| pka | 11.68±0.70(Predicted) |
| color | white |
| Odor | at 100.00?%. odorless |
| biological source | microbial |
| optical activity | [α]/D 174.0 to 180.0° |
| Water Solubility | 232g/L(25 ºC) |
| λmax | λ: 420 nm Amax: ≤0.20 |
| Merck | 14,2718 |
| BRN | 5725162 |
| Stability: | Hygroscopic |
| InChIKey | GDSRMADSINPKSL-HSEONFRVSA-N |
| SMILES | [H][C@]1(O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@@H]2[C@@H](COC(C)=O)O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O |
| LogP | -12.02 |
| EPA Substance Registry System | .gamma.-Cyclodextrin (17465-86-0) |
Description and Uses
γ-Cyclodextrin can be used as a precursor for the synthesis of:
- Octakis-(2,3-di-O-methyl-6-O-carboxymethyl)-γ-cyclodextrin sodium salt (ODMCM). ODMCM is used in capillary electrophoresis as a chiral resolving agent.
- Water-soluble cyclodextrin thioethers derivatives for the transportation of hydrophobic drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 2 |
| RTECS | GU2293080 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 13 - Non Combustible Solids |






