A2281212
2-Chloro-4-nitroaniline , 98% , 121-87-9
Synonym(s):
1-Amino-2-chloro-4-nitrobenzene;2-Chloro-4-nitroaniline;4-Amino-3-chloronitrobenzene
CAS NO.：121-87-9
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00007665
EINECS: 204-502-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107 °C |
| Boiling point: | 320℃ |
| Density | 1.5000 |
| bulk density | 850kg/m3 |
| refractive index | 1.6460 (estimate) |
| Flash point: | 205 °C |
| storage temp. | Store below +30°C. |
| solubility | 0.23g/l |
| pka | -1.05±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| PH | 7 (0.23g/l, H2O, 20℃) |
| Water Solubility | 0.23 g/L (20 ºC) |
| BRN | 638657 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, strong acids. |
| InChI | 1S/C6H5ClN2O2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H,8H2 |
| InChIKey | LOCWBQIWHWIRGN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 121-87-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2-chloro-4-nitro-(121-87-9) |
| EPA Substance Registry System | 2-Chloro-4-nitroaniline (121-87-9) |
Description and Uses
Intermediate in manufacture of dyes.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 22-24-61 |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | BX1400000 |
| Autoignition Temperature | 971 °F |
| TSCA | TSCA listed |
| HS Code | 2921 42 00 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Hazardous Substances Data | 121-87-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 6430 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
