A2304612
3-Chlorobenzoyl chloride , 97% , 618-46-2
CAS NO.:618-46-2
Empirical Formula: C7H4Cl2O
Molecular Weight: 175.01
MDL number: MFCD00000671
EINECS: 210-552-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500G | RMB409.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6.85°C |
| Boiling point: | 225 °C (lit.) |
| Density | 1.367 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform, Hexanes |
| form | Liquid |
| color | Clear colorless |
| Sensitive | Moisture Sensitive |
| BRN | 386256 |
| InChI | InChI=1S/C7H4Cl2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
| InChIKey | WHIHIKVIWVIIER-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(Cl)=C1 |
| CAS DataBase Reference | 618-46-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 3-chloro-(618-46-2) |
| EPA Substance Registry System | Benzoyl chloride, 3-chloro- (618-46-2) |
Description and Uses
3-Chlorobenzoyl Chloride is used in the synthesis of isoquinoline derivatives as potent CRTH2 antagonists in treatment of allergies. Also used in the synthesis of anticancer 2-phenzainamine derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-36/37/39-45-28A |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 1 |
| F | 19 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








