A6154712
3-Nitrobenzaldehyde , 98% , 99-61-6
Synonym(s):
3-Nitrobenzaldehyde
CAS NO.:99-61-6
Empirical Formula: C7H5NO3
Molecular Weight: 151.12
MDL number: MFCD00007249
EINECS: 202-772-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB50.40 | In Stock |
|
| 500G | RMB187.20 | In Stock |
|
| 2.5KG | RMB815.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56 °C |
| Boiling point: | 285-290 °C |
| Density | 1.2792 |
| vapor density | 5.21 (vs air) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 164°C/23mm |
| storage temp. | Store below +30°C. |
| solubility | 1.6g/l |
| form | Granular Powder |
| color | Yellow to yellow-brown |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| Merck | 14,6587 |
| BRN | 386795 |
| InChI | 1S/C7H5NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5H |
| InChIKey | ZETIVVHRRQLWFW-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(C=O)c1 |
| LogP | 1.47 |
| CAS DataBase Reference | 99-61-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 3-nitro-(99-61-6) |
| EPA Substance Registry System | Benzaldehyde, 3-nitro- (99-61-6) |
Description and Uses
3-Nitrobenzaldehyde, meta-nitrobenzaldehyde or m-nitrobenzaldehyde is an organic aromatic compound containing a nitro group meta-substituted to an aldehyde. 3-Nitrobenzaldehyde is the primary product obtained via the mono-nitration of benzaldehyde with nitric acid.
3-Nitrobenzaldehyde is a benzaldhyde with a nitro group in the meta position.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-36-24/25-61-37/39-29 |
| RIDADR | UN3077 |
| WGK Germany | 3 |
| RTECS | CU7250000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Toxicity | LD50 orally in Rabbit: 1075 mg/kg |







