A2305412
Coenzyme Q0 , 97% , 605-94-7
Synonym(s):
Coenzyme Q0
CAS NO.:605-94-7
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00001595
EINECS: 210-100-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60 °C(lit.) |
| Boiling point: | 331.4±42.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| Water Solubility | almost transparency in hot Water |
| solubility | DMF: 100 mg/ml; DMSO: 100 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): 0.2 mg/ml |
| form | Crystalline Powder or Needles |
| color | Red to orange |
| Sensitive | Light Sensitive |
| BRN | 1640422 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents. |
| InChI | 1S/C9H10O4/c1-5-4-6(10)8(12-2)9(13-3)7(5)11/h4H,1-3H3 |
| InChIKey | UIXPTCZPFCVOQF-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C(=O)C(C)=CC1=O |
| CAS DataBase Reference | 605-94-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethoxy-5-methyl-(605-94-7) |
Description and Uses
2,3-Dimethoxy-5-methyl-p-benzoquinone (Ubidecarenone EP Impurity A)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| F | 8-10-21 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





