A2306212
3-Chlorobenzyl bromide , 97% , 766-80-3
Synonym(s):
α-Bromo-3-chlorotoluene
CAS NO.:766-80-3
Empirical Formula: C7H6BrCl
Molecular Weight: 205.48
MDL number: MFCD00000597
EINECS: 212-171-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 10G | RMB67.20 | In Stock |
|
| 25g | RMB112.00 | In Stock |
|
| 50G | RMB264.80 | In Stock |
|
| 100g | RMB509.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15 °C |
| Boiling point: | 109-110 °C/12 mmHg (lit.) |
| Density | 1.565 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Specific Gravity | 1.565 |
| Water Solubility | DECOMPOSES |
| Sensitive | Lachrymatory |
| BRN | 636504 |
| InChI | InChI=1S/C7H6BrCl/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | LZIYAIRGDHSVED-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(Cl)=C1 |
| CAS DataBase Reference | 766-80-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(bromomethyl)-3-chloro-(766-80-3) |
Description and Uses
3-Chlorobenzyl bromide was used in the synthesis of symmetrical and unsymmetrical benzyl thioethers. It was used as starting reagent during the synthesis of 1-(3-chlorobenzyl)-2-(pyrrolidin-1-ylmethyl)-1H-benzimidazole dihydrochloride.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







