A2309212
4-Cyanophenylboronic acid , 97% , 126747-14-6
Synonym(s):
(p-Cyanophenyl)boronic acid;4-Cyanobenzeneboronic acid;4-Cyanophenylboric acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 100G | RMB679.20 | In Stock |
|
| 500g | RMB3279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >350 °C (lit.) |
| Boiling point: | 355.9±44.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly) |
| form | Powder |
| pka | 7.38±0.10(Predicted) |
| color | White to yellow |
| BRN | 6593772 |
| InChI | InChI=1S/C7H6BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H |
| InChIKey | CEBAHYWORUOILU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C#N)C=C1)(O)O |
| CAS DataBase Reference | 126747-14-6(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![Methyl 1H-pyrrolo[2,3-b]pyridine-6-carboxylate](https://img.chemicalbook.com/CAS/GIF/1256825-86-1.gif)

