A2309912
Colchicine , For plant cell culture, ≥98%(HPLC) , 64-86-8
Synonym(s):
(S)-N-(5,6,7,9-Tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl)acetamide;Colchicine;Colchicine, Colchicum autumnale - CAS 64-86-8 - Calbiochem
CAS NO.:64-86-8
Empirical Formula: C22H25NO6
Molecular Weight: 399.44
MDL number: MFCD00078484
EINECS: 200-598-5
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB479.20 | In Stock |
|
| 1G | RMB796.00 | In Stock |
|
| 5G | RMB3184.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-160 °C (dec.)(lit.) |
| alpha | -250 º (c=1, alcohol) |
| Boiling point: | 522.37°C (rough estimate) |
| Density | 1.2770 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 10 mg/mL |
| pka | 12.36(at 20℃) |
| form | powder |
| color | white to yellow with a green cast |
| Water Solubility | 45 g/L (20 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,2471 |
| BRN | 2228813 |
| BCS Class | 3 |
| Stability: | Stable. Light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | agriculture |
| InChI | 1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
| SMILES | COC1=CC=C2C(=CC1=O)[C@H](CCc3cc(OC)c(OC)c(OC)c23)NC(C)=O |
| LogP | 1.300 |
| CAS DataBase Reference | 64-86-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Colchicine(64-86-8) |
| EPA Substance Registry System | Colchicine (64-86-8) |
Description and Uses
Colchicine is a pale-yellow powder that is obtained from various species of Colchicum, primarily Colchicum autumnale L. Its total chemical synthesis has been achieved, but the primary source of colchicine currently remains alcohol extraction of the alkaloid from the corm and seed of C. autumnale L. It darkens on exposure to light and possesses
anti-inflammatory agent, mitosis inhibitor
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H340 |
| Precautionary statements | P202-P264-P270-P280-P301+P310-P405 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,T,Xi |
| Risk Statements | 26/28-41-46 |
| Safety Statements | 13-45-36/37/39-28-26-53 |
| RIDADR | UN 1544 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GH0700000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29399990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Muta. 1B |
| Hazardous Substances Data | 64-86-8(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): 1.6 i.v. (Rosenbloom, Ferguson); in mice (mg/kg): 4.13 i.v. (Beliles) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (300g or 300ml) |






