PRODUCT Properties
| Melting point: | 298° |
| alpha | D20 -47° (pyridine); D20 -32° (10% aq pyridine) |
| Boiling point: | 466.08°C (rough estimate) |
| Density | 1.3597 (rough estimate) |
| refractive index | 1.5376 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated), Pyridine (Slightly, Sonicated) |
| pka | 6.45±0.20(Predicted) |
| form | Solid |
| color | White to Light Brown |
| λmax | 271nm(MeOH)(lit.) |
| InChIKey | ISQRJFLLIDGZEP-JNAFRSBINA-N |
| SMILES | C12C(O)=CC(O)=CC=1OC=C(C1C=CC(O[C@H]3[C@H](O)[C@H]([C@H](O)[C@@H](CO)O3)O)=CC=1)C2=O |&1:16,17,19,20,22,r| |
| CAS DataBase Reference | 152-95-4(CAS DataBase Reference) |
Description and Uses
Genistein 4''-β-D-glucopyranoside is a metabolite of Genistein (G350000), which exhibits specific inhibitory activity against tyrosine kinases,including autophosphorylation of epidermal growth factor receptor kinase (IC50 - 2.6uM). Also inhibits other protein kinases through competitive inhibition of ATP. Inhibits tumor cell proliferation and induces tumor cell differentiation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| HS Code | 29329990 |
