A7094012
Quercetin dihydrate , 97% , 6151-25-3
Synonym(s):
2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one dihydrate;3,3ʹ,4ʹ,5,7-Pentahydroxyflavone;3,3′,4′,5,7-Pentahydroxyflavone dihydrate;Quercetin, Dihydrate - CAS 6151-25-3 - Calbiochem
CAS NO.:6151-25-3
Empirical Formula: C15H14O9
Molecular Weight: 338.27
MDL number: MFCD00149487
EINECS: 612-158-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB59.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 50G | RMB136.80 | In Stock |
|
| 100G | RMB223.20 | In Stock |
|
| 250G | RMB545.60 | In Stock |
|
| 500g | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1.680 g/cm3 |
| storage temp. | -20°C |
| solubility | Soluble in DMSO > 10 mM |
| form | Yellow solid |
| Colour Index | 75670 |
| color | Yellow |
| Water Solubility | practically insoluble |
| Merck | 14,8034 |
| BRN | 317313 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C15H10O7.2H2O/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;;/h1-5,16-19,21H;2*1H2 |
| InChIKey | GMGIWEZSKCNYSW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=C(C(=CC(=C2)O)O)C(=O)C=1O.[H]O[H].[H]O[H] |
| LogP | 2.075 (est) |
| CAS DataBase Reference | 6151-25-3(CAS DataBase Reference) |
Description and Uses
bioflavenoid, antioxidant, antiviral, antimicrobial, enzyme inhibitor
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25-46-23/24/25 |
| Safety Statements | 45-53 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LK8950000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29329990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | LD50 orally in mice: 160 mg/kg (Sullivan) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




