A5233812
Kaempferol , Analysis of standard products, ≥98% , 520-18-3
Synonym(s):
3,4ʹ,5,7-Tetrahydroxyflavone;3,4′,5,7-Tetrahydroxyflavone;3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;Kaempferol - CAS 520-18-3 - Calbiochem;Robigenin
CAS NO.:520-18-3
Empirical Formula: C15H10O6
Molecular Weight: 286.24
MDL number: MFCD00016938
EINECS: 208-287-6
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB95.20 | In Stock |
|
| 100mg | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 276°C |
| Boiling point: | 348.61°C (rough estimate) |
| Density | 1.2981 (rough estimate) |
| refractive index | 1.4413 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol: 20 mg/mL |
| pka | 6.34±0.40(Predicted) |
| form | powder |
| Colour Index | 75640 |
| color | yellow |
| biological source | synthetic |
| Merck | 14,5274 |
| BRN | 304401 |
| Stability: | Unstable in Solution |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT ANTIOXIDANT |
| InChI | 1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H |
| InChIKey | IYRMWMYZSQPJKC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2=C(O)C(=O)c3c(O)cc(O)cc3O2 |
| LogP | 2.685 (est) |
| CAS DataBase Reference | 520-18-3(CAS DataBase Reference) |
| IARC | 3 (Vol. 31, Sup 7) 1987 |
Description and Uses
Chromogenic reagent for antimony in the low ppm range and for gallium and indium in the sub-ppm range.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-68-25 |
| Safety Statements | 26-36-45-36/37-36/37/38-22 |
| RIDADR | 2811 |
| WGK Germany | - |
| RTECS | LK9275200 |
| F | 8-10-23 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 520-18-3(Hazardous Substances Data) |





