A7685558
Kaempferide , 10mMinDMSO , 491-54-3
Synonym(s):
3,5,7-Trihydroxy-4′-methoxyflavone;4′-Methoxy-3,5,7-trihydroxyflavone;KF
CAS NO.:491-54-3
Empirical Formula: C16H12O6
Molecular Weight: 300.26
MDL number: MFCD00081057
EINECS: 207-738-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-157 °C(lit.) |
| Boiling point: | 543.8±50.0 °C(Predicted) |
| Density | 1.538 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly, Heated), Methanol (Slightly, Heat |
| pka | 6.32±0.40(Predicted) |
| form | Solid |
| color | Yellow |
| BRN | 305378 |
| InChI | InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| InChIKey | SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C=C2)OC2=CC(O)=CC(O)=C2C(=O)C=1O |
| LogP | 2.740 (est) |
| CAS DataBase Reference | 491-54-3 |
Description and Uses
Kaempferide is a flavonoid that maintains anti-radical and anti-oxidant capabilities, as well as anti-tumour possibilities. Impurity of Icaritin (I163700).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | KD4170000 |
| HS Code | 29329990 |




