A2312212
Cyclophosphamide monohydrate , 97% , 6055-19-2
Synonym(s):
2-[Bis(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide;Cyclophosphamide Monohydrate - CAS 6055-19-2 - Calbiochem;Cytoxan;N,N- bis(2-Chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine-2-oxide Monohydrate, CPA;N,N-bis(2-Chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine-2-oxide Monohydrate, CPA
CAS NO.:6055-19-2
Empirical Formula: C7H17Cl2N2O3P
Molecular Weight: 279.1
MDL number: MFCD00149395
EINECS: 200-015-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB585.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-51 °C (lit.) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| Water Solubility | 40 g/L |
| Merck | 14,2747 |
| BRN | 8167897 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C7H15Cl2N2O2P.H2O/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14;/h1-7H2,(H,10,12);1H2 |
| InChIKey | PWOQRKCAHTVFLB-UHFFFAOYSA-N |
| SMILES | P1(=O)(OCCCN1)N(CCCl)CCCl.O |
| CAS DataBase Reference | 6055-19-2(CAS DataBase Reference) |
| IARC | 1 (Vol. 26, Sup 7, 100A) 2012 |
| EPA Substance Registry System | Cyclophosphamide monohydrate (6055-19-2) |
Description and Uses
alkylating agent in cancer therapy
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H340-H350-H360FD |
| Precautionary statements | P202-P264-P270-P280-P301+P310-P405 |
| Hazard Codes | T |
| Risk Statements | 45-25-61-46-36/37/38-23/24/25 |
| Safety Statements | 53-45-37/39-26 |
| RIDADR | UN 3464 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RP6157750 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 1B Muta. 1B Repr. 1A |






