A2312612
Adenosine 3′,5′-cyclic monophosphate(cAMP) , 99% , 60-92-4
CAS NO.:60-92-4
Empirical Formula: C10H12N5O6P
Molecular Weight: 329.21
MDL number: MFCD00005845
EINECS: 200-492-9
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB49.60 | In Stock |
|
| 1G | RMB76.80 | In Stock |
|
| 5G | RMB305.60 | In Stock |
|
| 25g | RMB1183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260 °C (dec.)(lit.) |
| alpha | -53.7 º (c=0.7,water) |
| Boiling point: | 56.12°C |
| Density | 2.47±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: 10 mg/mL pH of aqueous solution is approx. 3.0. The sodium salt (A6885) is about 20× |
| form | powder |
| pka | 1.00±0.60(Predicted) |
| color | white |
| biological source | mouse |
| Water Solubility | 50 mg/mL |
| Merck | 14,2708 |
| BRN | 52645 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | IVOMOUWHDPKRLL-KQYNXXCUSA-N |
| SMILES | Nc1ncnc2n(cnc12)[C@@H]3O[C@@H]4COP(O)(=O)O[C@H]4[C@H]3O |
| NIST Chemistry Reference | Adenosine 3',5'-cyclic monophosphate(60-92-4) |
| EPA Substance Registry System | Adenosine, cyclic 3',5'-(hydrogen phosphate) (60-92-4) |
Description and Uses
cAMP is used for intracellular signal transduction in many different organisms, conveying the cAMP-dependent pathway. Restoration of several morphological characteristics of normal fibroblasts in sarcoma cells when treated with adenosine-3': 5'-cyclic monophosphate. In the presence of adenosine 3':5'-cyclic monophosphate, protein kinase I dissociated into two subunits: a subunit binding adenosine 3':5'-cyclic monophosphate, and a catalytic subunit. Stimulation of calcium uptake in platelet membrane vesicles by adenosine 3',5'-cyclic monophosphate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P264b-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 22-24/25-45-36/37/39-26-36 |
| WGK Germany | 3 |
| RTECS | AU7357600 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | oms-hmn:oth 100 mmol/L JIDEAE 65,52,75 |





