A2313312
Cholesteryl chloroformate , 97% , 7144-08-3
CAS NO.:7144-08-3
Empirical Formula: C28H45ClO2
Molecular Weight: 449.12
MDL number: MFCD00003633
EINECS: 230-447-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB468.80 | In Stock |
|
| 100G | RMB1348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C (lit.) |
| Boiling point: | 556.35°C (rough estimate) |
| alpha | -28 º (c=2, CHCl3 27 ºC) |
| Density | 0.9344 (rough estimate) |
| refractive index | 1.5330 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | SLOWLY HYDROLYZED |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]27/D 28°, c = 2 in chloroform |
| Water Solubility | SLOWLY HYDROLYZED |
| Sensitive | Moisture Sensitive |
| BRN | 3223154 |
| InChIKey | QNEPTKZEXBPDLF-JDTILAPWSA-N |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(Cl)=O |
| CAS DataBase Reference | 7144-08-3(CAS DataBase Reference) |
| EPA Substance Registry System | Cholest-5-en-3-ol (3.beta.)-, carbonochloridate (7144-08-3) |
Description and Uses
Cholesteryl chloroformate is used in the preparation of hydrophobized chitosan oligosaccharide, which finds application as an efficient gene carrier. It acts as an initiator in the polymerization of methyl methacrylate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159020 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





